C13H20O5S — CID 158123605
[(6S)-6-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexa-2,4-dien-1-yl]methanesulfonic acid (PubChem CID 158123605) has the molecular formula C13H20O5S and a molecular weight of 288.37 g/mol. Its IUPAC name is [(6S)-6-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexa-2,4-dien-1-yl]methanesulfonic acid.
| Compound Name | [(6S)-6-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexa-2,4-dien-1-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 158123605 |
| Molecular Formula | C13H20O5S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | [(6S)-6-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexa-2,4-dien-1-yl]methanesulfonic acid |
| SMILES | C[C@H]1C=CC=CC1(CS(=O)(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H20O5S/c1-10-7-5-6-8-13(10,9-19(15,16)17)11(14)18-12(2,3)4/h5-8,10H,9H2,1-4H3,(H,15,16,17)/t10-,13?/m0/s1 |
| InChIKey | ZIQVNIFGQHBHJD-NKUHCKNESA-N |
| XLogP | 1.96 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|