C20H32N2O4 — CID 175286310
[[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino] 1,6-dimethylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 175286310) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is [[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino] 1,6-dimethylcyclohexa-2,4-diene-1-carboxylate.
| Compound Name | [[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino] 1,6-dimethylcyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 175286310 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | [[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]amino] 1,6-dimethylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | CC1C=CC=CC1(C)C(=O)ONC1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H32N2O4/c1-14-8-6-7-13-20(14,5)17(23)26-22-16-11-9-15(10-12-16)21-18(24)25-19(2,3)4/h6-8,13-16,22H,9-12H2,1-5H3,(H,21,24) |
| InChIKey | QSTQOOCQUHQZPO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|