C11H14N2 — CID 158138290
1-hexa-1,3,5-triynyl-4-methylpiperazine;molecular hydrogen (PubChem CID 158138290) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 1-hexa-1,3,5-triynyl-4-methylpiperazine;molecular hydrogen.
| Compound Name | 1-hexa-1,3,5-triynyl-4-methylpiperazine;molecular hydrogen |
|---|---|
| PubChem CID | 158138290 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 1-hexa-1,3,5-triynyl-4-methylpiperazine;molecular hydrogen |
| SMILES | C#CC#CC#CN1CCN(C)CC1.[H][H] |
| InChI | InChI=1S/C11H12N2.H2/c1-3-4-5-6-7-13-10-8-12(2)9-11-13;/h1H,8-11H2,2H3;1H |
| InChIKey | FTPVSIHKZKWCJQ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|