About 1-hexa-1,3,5-triynyl-4-methylpiperazine;molecular hydrogen
1-hexa-1,3,5-triynyl-4-methylpiperazine;molecular hydrogen (PubChem CID 158138290) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 1-hexa-1,3,5-triynyl-4-methylpiperazine;molecular hydrogen.
Molecular Properties
| Compound Name | 1-hexa-1,3,5-triynyl-4-methylpiperazine;molecular hydrogen |
| PubChem CID | 158138290 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 1-hexa-1,3,5-triynyl-4-methylpiperazine;molecular hydrogen |
| SMILES | C#CC#CC#CN1CCN(C)CC1.[H][H] |
| InChI | InChI=1S/C11H12N2.H2/c1-3-4-5-6-7-13-10-8-12(2)9-11-13;/h1H,8-11H2,2H3;1H |
| InChIKey | FTPVSIHKZKWCJQ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-hexa-1,3,5-triynyl-4-methylpiperazine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexa-1,3,5-triynyl-4-methylpiperazine;molecular hydrogen?
The IUPAC name of 1-hexa-1,3,5-triynyl-4-methylpiperazine;molecular hydrogen (CID 158138290) is 1-hexa-1,3,5-triynyl-4-methylpiperazine;molecular hydrogen.
What is the SMILES notation for 1-hexa-1,3,5-triynyl-4-methylpiperazine;molecular hydrogen?
The canonical SMILES for 1-hexa-1,3,5-triynyl-4-methylpiperazine;molecular hydrogen is C#CC#CC#CN1CCN(C)CC1.[H][H].
What is the InChIKey of 1-hexa-1,3,5-triynyl-4-methylpiperazine;molecular hydrogen?
The InChIKey is FTPVSIHKZKWCJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2.H2/c1-3-4-5-6-7-13-10-8-12(2)9-11-13;/h1H,8-11H2,2H3;1H.
What are the key properties of 1-hexa-1,3,5-triynyl-4-methylpiperazine;molecular hydrogen?
1-hexa-1,3,5-triynyl-4-methylpiperazine;molecular hydrogen has a molecular weight of 174.25 g/mol, XLogP of 0.08, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexa-1,3,5-triynyl-4-methylpiperazine;molecular hydrogen is sourced from PubChem (CID 158138290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).