C11H15NO — CID 91554368
hexa-1,3,5-triyne;4-methylmorpholine;molecular hydrogen (PubChem CID 91554368) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is hexa-1,3,5-triyne;4-methylmorpholine;molecular hydrogen.
| Compound Name | hexa-1,3,5-triyne;4-methylmorpholine;molecular hydrogen |
|---|---|
| PubChem CID | 91554368 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | hexa-1,3,5-triyne;4-methylmorpholine;molecular hydrogen |
| SMILES | C#CC#CC#C.CN1CCOCC1.[H][H] |
| InChI | InChI=1S/C6H2.C5H11NO.H2/c1-3-5-6-4-2;1-6-2-4-7-5-3-6;/h1-2H;2-5H2,1H3;1H |
| InChIKey | RTKNCNFQKMCXMH-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|