C90H55BClN6O4S2 — CID 158142672
CID 158142672 (PubChem CID 158142672) has the molecular formula C90H55BClN6O4S2 and a molecular weight of 1404.93 g/mol.
| Compound Name | CID 158142672 |
|---|---|
| PubChem CID | 158142672 |
| Molecular Formula | C90H55BClN6O4S2 |
| Molecular Weight | 1404.93 g/mol |
| Exact Mass | 1403.41 |
| IUPAC Name | — |
| SMILES | O[B]Oc1cccc2c1oc1c(-c3ccccc3)cccc12.[2H]c1c([2H])c([2H])c(-c2cccc3c2sc2c(-c4nc(-c5ccccc5)nc(-c5cccc6c5oc5c(-c7ccccc7)cccc56)n4)cccc23)c([2H])c1[2H].[2H]c1c([2H])c([2H])c(-c2cccc3c2sc2c(-c4nc(Cl)nc(-c5ccccc5)n4)cccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C45H27N3OS.C27H16ClN3S.C18H12BO3/c1-4-14-28(15-5-1)31-20-10-22-33-34-23-12-26-37(40(34)49-39(31)33)44-46-43(30-18-8-3-9-19-30)47-45(48-44)38-27-13-25-36-35-24-11-21-32(41(35)50-42(36)38)29-16-6-2-7-17-29;28-27-30-25(18-11-5-2-6-12-18)29-26(31-27)22-16-8-15-21-20-14-7-13-19(23(20)32-24(21)22)17-9-3-1-4-10-17;20-19-22-16-11-5-10-15-14-9-4-8-13(17(14)21-18(15)16)12-6-2-1-3-7-12/h1-27H;1-16H;1-11,20H/i2D,6D,7D,16D,17D;1D,3D,4D,9D,10D; |
| InChIKey | BIBGWXUMMYMQJZ-UFACYCFGSA-N |
| XLogP | 24.53 |
| TPSA | 133.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 104 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1404.93 |
| LogP ≤ 5 | 24.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|