About 1-(2,6-dimethylphenyl)-2,3-dimethylpyrrolo[3,2-b]indolizine
1-(2,6-dimethylphenyl)-2,3-dimethylpyrrolo[3,2-b]indolizine (PubChem CID 158207556) has the molecular formula C20H20N2
and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-2,3-dimethylpyrrolo[3,2-b]indolizine.
Molecular Properties
| Compound Name | 1-(2,6-dimethylphenyl)-2,3-dimethylpyrrolo[3,2-b]indolizine |
| PubChem CID | 158207556 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-2,3-dimethylpyrrolo[3,2-b]indolizine |
| SMILES | Cc1cccc(C)c1-n1c(C)c(C)c2cc3ccccn3c21 |
| InChI | InChI=1S/C20H20N2/c1-13-8-7-9-14(2)19(13)22-16(4)15(3)18-12-17-10-5-6-11-21(17)20(18)22/h5-12H,1-4H3 |
| InChIKey | VXFRDSOMZFXQJA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 9.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,6-dimethylphenyl)-2,3-dimethylpyrrolo[3,2-b]indolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-dimethylphenyl)-2,3-dimethylpyrrolo[3,2-b]indolizine?
The IUPAC name of 1-(2,6-dimethylphenyl)-2,3-dimethylpyrrolo[3,2-b]indolizine (CID 158207556) is 1-(2,6-dimethylphenyl)-2,3-dimethylpyrrolo[3,2-b]indolizine.
What is the SMILES notation for 1-(2,6-dimethylphenyl)-2,3-dimethylpyrrolo[3,2-b]indolizine?
The canonical SMILES for 1-(2,6-dimethylphenyl)-2,3-dimethylpyrrolo[3,2-b]indolizine is Cc1cccc(C)c1-n1c(C)c(C)c2cc3ccccn3c21.
What is the InChIKey of 1-(2,6-dimethylphenyl)-2,3-dimethylpyrrolo[3,2-b]indolizine?
The InChIKey is VXFRDSOMZFXQJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2/c1-13-8-7-9-14(2)19(13)22-16(4)15(3)18-12-17-10-5-6-11-21(17)20(18)22/h5-12H,1-4H3.
What are the key properties of 1-(2,6-dimethylphenyl)-2,3-dimethylpyrrolo[3,2-b]indolizine?
1-(2,6-dimethylphenyl)-2,3-dimethylpyrrolo[3,2-b]indolizine has a molecular weight of 288.39 g/mol, XLogP of 5.12, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dimethylphenyl)-2,3-dimethylpyrrolo[3,2-b]indolizine is sourced from PubChem (CID 158207556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).