C15H15N2+ — CID 102144298
2-(2,6-dimethylphenyl)imidazo[1,5-a]pyridin-2-ium (PubChem CID 102144298) has the molecular formula C15H15N2+ and a molecular weight of 223.30 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)imidazo[1,5-a]pyridin-2-ium.
| Compound Name | 2-(2,6-dimethylphenyl)imidazo[1,5-a]pyridin-2-ium |
|---|---|
| PubChem CID | 102144298 |
| Molecular Formula | C15H15N2+ |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 2-(2,6-dimethylphenyl)imidazo[1,5-a]pyridin-2-ium |
| SMILES | Cc1cccc(C)c1-[n+]1cc2ccccn2c1 |
| InChI | InChI=1S/C15H15N2/c1-12-6-5-7-13(2)15(12)17-10-14-8-3-4-9-16(14)11-17/h3-11H,1-2H3/q+1 |
| InChIKey | DSOHLCYPOLRPGZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|