C16H23N2+ — CID 155603187
4-tert-butyl-1-(2,6-dimethylphenyl)-3-methylimidazol-1-ium (PubChem CID 155603187) has the molecular formula C16H23N2+ and a molecular weight of 243.37 g/mol. Its IUPAC name is 4-tert-butyl-1-(2,6-dimethylphenyl)-3-methylimidazol-1-ium.
| Compound Name | 4-tert-butyl-1-(2,6-dimethylphenyl)-3-methylimidazol-1-ium |
|---|---|
| PubChem CID | 155603187 |
| Molecular Formula | C16H23N2+ |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | 4-tert-butyl-1-(2,6-dimethylphenyl)-3-methylimidazol-1-ium |
| SMILES | Cc1cccc(C)c1-[n+]1cc(C(C)(C)C)n(C)c1 |
| InChI | InChI=1S/C16H23N2/c1-12-8-7-9-13(2)15(12)18-10-14(16(3,4)5)17(6)11-18/h7-11H,1-6H3/q+1 |
| InChIKey | HKXNNFSOTXZWDW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|