About silver 2,6-dimethylbenzenethiolate
silver 2,6-dimethylbenzenethiolate (PubChem CID 101015873) has the molecular formula C8H9AgS
and a molecular weight of 245.09 g/mol. Its IUPAC name is silver 2,6-dimethylbenzenethiolate.
Molecular Properties
| Compound Name | silver 2,6-dimethylbenzenethiolate |
| PubChem CID | 101015873 |
| Molecular Formula | C8H9AgS |
| Molecular Weight | 245.09 g/mol |
| Exact Mass | 243.95 |
| IUPAC Name | silver 2,6-dimethylbenzenethiolate |
| SMILES | Cc1cccc(C)c1[S-].[Ag+] |
| InChI | InChI=1S/C8H10S.Ag/c1-6-4-3-5-7(2)8(6)9;/h3-5,9H,1-2H3;/q;+1/p-1 |
| InChIKey | BPHNVJPJNFLFMM-UHFFFAOYSA-M |
| XLogP | 2.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.09 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze silver 2,6-dimethylbenzenethiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver 2,6-dimethylbenzenethiolate?
The IUPAC name of silver 2,6-dimethylbenzenethiolate (CID 101015873) is silver 2,6-dimethylbenzenethiolate.
What is the SMILES notation for silver 2,6-dimethylbenzenethiolate?
The canonical SMILES for silver 2,6-dimethylbenzenethiolate is Cc1cccc(C)c1[S-].[Ag+].
What is the InChIKey of silver 2,6-dimethylbenzenethiolate?
The InChIKey is BPHNVJPJNFLFMM-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H10S.Ag/c1-6-4-3-5-7(2)8(6)9;/h3-5,9H,1-2H3;/q;+1/p-1.
What are the key properties of silver 2,6-dimethylbenzenethiolate?
silver 2,6-dimethylbenzenethiolate has a molecular weight of 245.09 g/mol, XLogP of 2.21, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for silver 2,6-dimethylbenzenethiolate is sourced from PubChem (CID 101015873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).