C29H48O14 — CID 158213530
[(2R)-4-[(2R)-4-[(3R)-3-hydroxybutoxy]-4-oxobutan-2-yl]oxy-4-oxobutan-2-yl] (3R)-3-methoxybutanoate;(4R,8R,12R)-4,8,12-trimethyl-1,5,9-trioxacyclododecane-2,6,10-trione (PubChem CID 158213530) has the molecular formula C29H48O14 and a molecular weight of 620.69 g/mol. Its IUPAC name is [(2R)-4-[(2R)-4-[(3R)-3-hydroxybutoxy]-4-oxobutan-2-yl]oxy-4-oxobutan-2-yl] (3R)-3-methoxybutanoate;(4R,8R,12R)-4,8,12-trimethyl-1,5,9-trioxacyclododecane-2,6,10-trione.
| Compound Name | [(2R)-4-[(2R)-4-[(3R)-3-hydroxybutoxy]-4-oxobutan-2-yl]oxy-4-oxobutan-2-yl] (3R)-3-methoxybutanoate;(4R,8R,12R)-4,8,12-trimethyl-1,5,9-trioxacyclododecane-2,6,10-trione |
|---|---|
| PubChem CID | 158213530 |
| Molecular Formula | C29H48O14 |
| Molecular Weight | 620.69 g/mol |
| Exact Mass | 620.30 |
| IUPAC Name | [(2R)-4-[(2R)-4-[(3R)-3-hydroxybutoxy]-4-oxobutan-2-yl]oxy-4-oxobutan-2-yl] (3R)-3-methoxybutanoate;(4R,8R,12R)-4,8,12-trimethyl-1,5,9-trioxacyclododecane-2,6,10-trione |
| SMILES | CO[C@H](C)CC(=O)O[C@H](C)CC(=O)O[C@H](C)CC(=O)OCC[C@@H](C)O.C[C@@H]1CC(=O)O[C@H](C)CC(=O)O[C@H](C)CC(=O)O1 |
| InChI | InChI=1S/C17H30O8.C12H18O6/c1-11(18)6-7-23-15(19)9-13(3)24-17(21)10-14(4)25-16(20)8-12(2)22-5;1-7-4-10(13)17-9(3)6-12(15)18-8(2)5-11(14)16-7/h11-14,18H,6-10H2,1-5H3;7-9H,4-6H2,1-3H3/t11-,12-,13-,14-;7-,8-,9-/m11/s1 |
| InChIKey | GCJCMTQBJWCXJL-IMZXUSPBSA-N |
| XLogP | 2.33 |
| TPSA | 187.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.69 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|