C17H32O4S2 — CID 158219996
6,8-bis(prop-1-en-2-yloxymethylsulfanyl)octanoic acid;methane (PubChem CID 158219996) has the molecular formula C17H32O4S2 and a molecular weight of 364.57 g/mol. Its IUPAC name is 6,8-bis(prop-1-en-2-yloxymethylsulfanyl)octanoic acid;methane.
| Compound Name | 6,8-bis(prop-1-en-2-yloxymethylsulfanyl)octanoic acid;methane |
|---|---|
| PubChem CID | 158219996 |
| Molecular Formula | C17H32O4S2 |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 6,8-bis(prop-1-en-2-yloxymethylsulfanyl)octanoic acid;methane |
| SMILES | C.C=C(C)OCSCCC(CCCCC(=O)O)SCOC(=C)C |
| InChI | InChI=1S/C16H28O4S2.CH4/c1-13(2)19-11-21-10-9-15(22-12-20-14(3)4)7-5-6-8-16(17)18;/h15H,1,3,5-12H2,2,4H3,(H,17,18);1H4 |
| InChIKey | GDCYZNNSFZWIHI-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|