C20H28O2S2 — CID 101375243
6,8-bis(cyclopenta-2,4-dien-1-ylmethylsulfanyl)octanoic acid (PubChem CID 101375243) has the molecular formula C20H28O2S2 and a molecular weight of 364.58 g/mol. Its IUPAC name is 6,8-bis(cyclopenta-2,4-dien-1-ylmethylsulfanyl)octanoic acid.
| Compound Name | 6,8-bis(cyclopenta-2,4-dien-1-ylmethylsulfanyl)octanoic acid |
|---|---|
| PubChem CID | 101375243 |
| Molecular Formula | C20H28O2S2 |
| Molecular Weight | 364.58 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 6,8-bis(cyclopenta-2,4-dien-1-ylmethylsulfanyl)octanoic acid |
| SMILES | O=C(O)CCCCC(CCSCC1C=CC=C1)SCC1C=CC=C1 |
| InChI | InChI=1S/C20H28O2S2/c21-20(22)12-6-5-11-19(24-16-18-9-3-4-10-18)13-14-23-15-17-7-1-2-8-17/h1-4,7-10,17-19H,5-6,11-16H2,(H,21,22) |
| InChIKey | BHVXAKCTTWNVMU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.58 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|