C30H29ClN2O4S — CID 158222572
3-chloro-N-[3-[3-[[2-methoxy-5-(3-methylphenyl)phenyl]sulfonylmethyl]phenyl]propyl]pyridine-2-carboxamide (PubChem CID 158222572) has the molecular formula C30H29ClN2O4S and a molecular weight of 549.09 g/mol. Its IUPAC name is 3-chloro-N-[3-[3-[[2-methoxy-5-(3-methylphenyl)phenyl]sulfonylmethyl]phenyl]propyl]pyridine-2-carboxamide.
| Compound Name | 3-chloro-N-[3-[3-[[2-methoxy-5-(3-methylphenyl)phenyl]sulfonylmethyl]phenyl]propyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 158222572 |
| Molecular Formula | C30H29ClN2O4S |
| Molecular Weight | 549.09 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | 3-chloro-N-[3-[3-[[2-methoxy-5-(3-methylphenyl)phenyl]sulfonylmethyl]phenyl]propyl]pyridine-2-carboxamide |
| SMILES | COc1ccc(-c2cccc(C)c2)cc1S(=O)(=O)Cc1cccc(CCCNC(=O)c2ncccc2Cl)c1 |
| InChI | InChI=1S/C30H29ClN2O4S/c1-21-7-3-11-24(17-21)25-13-14-27(37-2)28(19-25)38(35,36)20-23-9-4-8-22(18-23)10-5-16-33-30(34)29-26(31)12-6-15-32-29/h3-4,6-9,11-15,17-19H,5,10,16,20H2,1-2H3,(H,33,34) |
| InChIKey | GDKNPBZOZYTKGV-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.09 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|