C27H37BN2O4 — CID 158226488
tert-butyl (2S)-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5-dihydro-1H-benzo[e]indol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 158226488) has the molecular formula C27H37BN2O4 and a molecular weight of 464.42 g/mol. Its IUPAC name is tert-butyl (2S)-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5-dihydro-1H-benzo[e]indol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5-dihydro-1H-benzo[e]indol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 158226488 |
| Molecular Formula | C27H37BN2O4 |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | tert-butyl (2S)-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5-dihydro-1H-benzo[e]indol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C1=NC2=C(C1)c1ccc(B3OC(C)(C)C(C)(C)O3)cc1CC2 |
| InChI | InChI=1S/C27H37BN2O4/c1-25(2,3)32-24(31)30-14-8-9-23(30)22-16-20-19-12-11-18(15-17(19)10-13-21(20)29-22)28-33-26(4,5)27(6,7)34-28/h11-12,15,23H,8-10,13-14,16H2,1-7H3/t23-/m0/s1 |
| InChIKey | YQXUJRJLEPUEJZ-QHCPKHFHSA-N |
| XLogP | 4.89 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|