C34H25F6N3O2 — CID 158227862
3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methyl-9H-fluoren-1-amine;2-phenylpyrimidine-5-carboxylic acid (PubChem CID 158227862) has the molecular formula C34H25F6N3O2 and a molecular weight of 621.58 g/mol. Its IUPAC name is 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methyl-9H-fluoren-1-amine;2-phenylpyrimidine-5-carboxylic acid.
| Compound Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methyl-9H-fluoren-1-amine;2-phenylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 158227862 |
| Molecular Formula | C34H25F6N3O2 |
| Molecular Weight | 621.58 g/mol |
| Exact Mass | 621.19 |
| IUPAC Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methyl-9H-fluoren-1-amine;2-phenylpyrimidine-5-carboxylic acid |
| SMILES | Cc1c(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc2c(c1N)Cc1ccccc1-2.O=C(O)c1cnc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C23H17F6N.C11H8N2O2/c1-12-15(10-19-18-5-3-2-4-14(18)9-20(19)21(12)30)6-13-7-16(22(24,25)26)11-17(8-13)23(27,28)29;14-11(15)9-6-12-10(13-7-9)8-4-2-1-3-5-8/h2-5,7-8,10-11H,6,9,30H2,1H3;1-7H,(H,14,15) |
| InChIKey | GEAGPRPFGNCVEA-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.58 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|