C30H24Cl2N10O4 — CID 158243566
2-chloro-N-(3-isocyano-3-pyridin-2-ylcyclobutyl)-5-nitropyridin-4-amine (PubChem CID 158243566) has the molecular formula C30H24Cl2N10O4 and a molecular weight of 659.49 g/mol. Its IUPAC name is 2-chloro-N-(3-isocyano-3-pyridin-2-ylcyclobutyl)-5-nitropyridin-4-amine.
| Compound Name | 2-chloro-N-(3-isocyano-3-pyridin-2-ylcyclobutyl)-5-nitropyridin-4-amine |
|---|---|
| PubChem CID | 158243566 |
| Molecular Formula | C30H24Cl2N10O4 |
| Molecular Weight | 659.49 g/mol |
| Exact Mass | 658.14 |
| IUPAC Name | 2-chloro-N-(3-isocyano-3-pyridin-2-ylcyclobutyl)-5-nitropyridin-4-amine |
| SMILES | [C-]#[N+]C1(c2ccccn2)CC(Nc2cc(Cl)ncc2[N+](=O)[O-])C1.[C-]#[N+]C1(c2ccccn2)CC(Nc2cc(Cl)ncc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/2C15H12ClN5O2/c2*1-17-15(13-4-2-3-5-18-13)7-10(8-15)20-11-6-14(16)19-9-12(11)21(22)23/h2*2-6,9-10H,7-8H2,(H,19,20) |
| InChIKey | GFVSETUNLVIHKY-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 170.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.49 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|