C19H17ClN6O4 — CID 141365963
[(3S)-1-[6-(6-chloro-3-nitro-2-pyridinyl)-1,7-naphthyridin-4-yl]piperidin-3-yl]carbamic acid (PubChem CID 141365963) has the molecular formula C19H17ClN6O4 and a molecular weight of 428.84 g/mol. Its IUPAC name is [(3S)-1-[6-(6-chloro-3-nitro-2-pyridinyl)-1,7-naphthyridin-4-yl]piperidin-3-yl]carbamic acid.
| Compound Name | [(3S)-1-[6-(6-chloro-3-nitro-2-pyridinyl)-1,7-naphthyridin-4-yl]piperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 141365963 |
| Molecular Formula | C19H17ClN6O4 |
| Molecular Weight | 428.84 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | [(3S)-1-[6-(6-chloro-3-nitro-2-pyridinyl)-1,7-naphthyridin-4-yl]piperidin-3-yl]carbamic acid |
| SMILES | O=C(O)N[C@H]1CCCN(c2ccnc3cnc(-c4nc(Cl)ccc4[N+](=O)[O-])cc23)C1 |
| InChI | InChI=1S/C19H17ClN6O4/c20-17-4-3-16(26(29)30)18(24-17)13-8-12-14(9-22-13)21-6-5-15(12)25-7-1-2-11(10-25)23-19(27)28/h3-6,8-9,11,23H,1-2,7,10H2,(H,27,28)/t11-/m0/s1 |
| InChIKey | SUQMKIWHAJGGIS-NSHDSACASA-N |
| XLogP | 3.49 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.84 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|