C12H13Cl2N5O — CID 158245278
4,14-dichloro-11-methyl-8-oxa-2,6,12,16,17-pentazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene (PubChem CID 158245278) has the molecular formula C12H13Cl2N5O and a molecular weight of 314.18 g/mol. Its IUPAC name is 4,14-dichloro-11-methyl-8-oxa-2,6,12,16,17-pentazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene.
| Compound Name | 4,14-dichloro-11-methyl-8-oxa-2,6,12,16,17-pentazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene |
|---|---|
| PubChem CID | 158245278 |
| Molecular Formula | C12H13Cl2N5O |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 4,14-dichloro-11-methyl-8-oxa-2,6,12,16,17-pentazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene |
| SMILES | CC1CCOC2=NCC(Cl)=C2Nc2ncc(Cl)c(n2)N1 |
| InChI | InChI=1S/C12H13Cl2N5O/c1-6-2-3-20-11-9(7(13)4-15-11)18-12-16-5-8(14)10(17-6)19-12/h5-6H,2-4H2,1H3,(H2,16,17,18,19) |
| InChIKey | CRUITOJXSZYUKC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |