C27H28O5 — CID 158246186
(1S,9S,10R,11S)-3,5-dimethoxy-11-methyl-9-(4-methylphenyl)-10-phenyl-8-oxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-1,12-diol (PubChem CID 158246186) has the molecular formula C27H28O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is (1S,9S,10R,11S)-3,5-dimethoxy-11-methyl-9-(4-methylphenyl)-10-phenyl-8-oxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-1,12-diol.
| Compound Name | (1S,9S,10R,11S)-3,5-dimethoxy-11-methyl-9-(4-methylphenyl)-10-phenyl-8-oxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-1,12-diol |
|---|---|
| PubChem CID | 158246186 |
| Molecular Formula | C27H28O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | (1S,9S,10R,11S)-3,5-dimethoxy-11-methyl-9-(4-methylphenyl)-10-phenyl-8-oxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-1,12-diol |
| SMILES | COc1cc(OC)c2c(c1)O[C@@]1(c3ccc(C)cc3)C(O)[C@]2(O)[C@@H](C)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C27H28O5/c1-16-10-12-19(13-11-16)27-23(18-8-6-5-7-9-18)17(2)26(29,25(27)28)24-21(31-4)14-20(30-3)15-22(24)32-27/h5-15,17,23,25,28-29H,1-4H3/t17-,23+,25?,26-,27+/m0/s1 |
| InChIKey | OGHJDCOPLOTUAZ-BOIZAZRBSA-N |
| XLogP | 4.28 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |