C18H36Cl2N6O4 — CID 158250448
4-aminopiperidine-4-carboxamide;tert-butyl 4-amino-4-carbamoylpiperidine-1-carboxylate;dichloromethane (PubChem CID 158250448) has the molecular formula C18H36Cl2N6O4 and a molecular weight of 471.43 g/mol. Its IUPAC name is 4-aminopiperidine-4-carboxamide;tert-butyl 4-amino-4-carbamoylpiperidine-1-carboxylate;dichloromethane.
| Compound Name | 4-aminopiperidine-4-carboxamide;tert-butyl 4-amino-4-carbamoylpiperidine-1-carboxylate;dichloromethane |
|---|---|
| PubChem CID | 158250448 |
| Molecular Formula | C18H36Cl2N6O4 |
| Molecular Weight | 471.43 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 4-aminopiperidine-4-carboxamide;tert-butyl 4-amino-4-carbamoylpiperidine-1-carboxylate;dichloromethane |
| SMILES | CC(C)(C)OC(=O)N1CCC(N)(C(N)=O)CC1.ClCCl.NC(=O)C1(N)CCNCC1 |
| InChI | InChI=1S/C11H21N3O3.C6H13N3O.CH2Cl2/c1-10(2,3)17-9(16)14-6-4-11(13,5-7-14)8(12)15;7-5(10)6(8)1-3-9-4-2-6;2-1-3/h4-7,13H2,1-3H3,(H2,12,15);9H,1-4,8H2,(H2,7,10);1H2 |
| InChIKey | GGQLBMYODGZMBJ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 179.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.43 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|