C21H22ClFO2S — CID 158251686
2-(4-chloro-3-methoxyphenyl)-7-(4-fluorophenyl)-2-methyl-6-sulfanylideneheptan-3-one (PubChem CID 158251686) has the molecular formula C21H22ClFO2S and a molecular weight of 392.92 g/mol. Its IUPAC name is 2-(4-chloro-3-methoxyphenyl)-7-(4-fluorophenyl)-2-methyl-6-sulfanylideneheptan-3-one.
| Compound Name | 2-(4-chloro-3-methoxyphenyl)-7-(4-fluorophenyl)-2-methyl-6-sulfanylideneheptan-3-one |
|---|---|
| PubChem CID | 158251686 |
| Molecular Formula | C21H22ClFO2S |
| Molecular Weight | 392.92 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 2-(4-chloro-3-methoxyphenyl)-7-(4-fluorophenyl)-2-methyl-6-sulfanylideneheptan-3-one |
| SMILES | COc1cc(C(C)(C)C(=O)CCC(=S)Cc2ccc(F)cc2)ccc1Cl |
| InChI | InChI=1S/C21H22ClFO2S/c1-21(2,15-6-10-18(22)19(13-15)25-3)20(24)11-9-17(26)12-14-4-7-16(23)8-5-14/h4-8,10,13H,9,11-12H2,1-3H3 |
| InChIKey | HMNCBYIFTVYVKY-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.92 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|