C38H37N7O3 — CID 158268620
N-[(3Z)-3-[[4-[[2-(1,4-diazepan-1-yl)acetyl]-methylamino]anilino]-phenylmethylidene]-2-oxo-1H-indol-6-yl]-3H-indole-2-carboxamide (PubChem CID 158268620) has the molecular formula C38H37N7O3 and a molecular weight of 639.76 g/mol. Its IUPAC name is N-[(3Z)-3-[[4-[[2-(1,4-diazepan-1-yl)acetyl]-methylamino]anilino]-phenylmethylidene]-2-oxo-1H-indol-6-yl]-3H-indole-2-carboxamide.
| Compound Name | N-[(3Z)-3-[[4-[[2-(1,4-diazepan-1-yl)acetyl]-methylamino]anilino]-phenylmethylidene]-2-oxo-1H-indol-6-yl]-3H-indole-2-carboxamide |
|---|---|
| PubChem CID | 158268620 |
| Molecular Formula | C38H37N7O3 |
| Molecular Weight | 639.76 g/mol |
| Exact Mass | 639.30 |
| IUPAC Name | N-[(3Z)-3-[[4-[[2-(1,4-diazepan-1-yl)acetyl]-methylamino]anilino]-phenylmethylidene]-2-oxo-1H-indol-6-yl]-3H-indole-2-carboxamide |
| SMILES | CN(C(=O)CN1CCCNCC1)c1ccc(N/C(=C2\C(=O)Nc3cc(NC(=O)C4=Nc5ccccc5C4)ccc32)c2ccccc2)cc1 |
| InChI | InChI=1S/C38H37N7O3/c1-44(34(46)24-45-20-7-18-39-19-21-45)29-15-12-27(13-16-29)40-36(25-8-3-2-4-9-25)35-30-17-14-28(23-32(30)43-38(35)48)41-37(47)33-22-26-10-5-6-11-31(26)42-33/h2-6,8-17,23,39-40H,7,18-22,24H2,1H3,(H,41,47)(H,43,48)/b36-35- |
| InChIKey | GITJHHCGXYNNRW-KXYMVQBMSA-N |
| XLogP | 5.14 |
| TPSA | 118.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.76 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|