C33H36N4O4 — CID 158726760
methyl (3E)-3-[2-[4-[[2-(2,2,3,3,5,6,6-heptadeuterio-4,5-dimethylpiperazin-1-yl)acetyl]-methylamino]phenyl]-1-phenylethylidene]-2-oxo-1H-indole-6-carboxylate (PubChem CID 158726760) has the molecular formula C33H36N4O4 and a molecular weight of 559.72 g/mol. Its IUPAC name is methyl (3E)-3-[2-[4-[[2-(2,2,3,3,5,6,6-heptadeuterio-4,5-dimethylpiperazin-1-yl)acetyl]-methylamino]phenyl]-1-phenylethylidene]-2-oxo-1H-indole-6-carboxylate.
| Compound Name | methyl (3E)-3-[2-[4-[[2-(2,2,3,3,5,6,6-heptadeuterio-4,5-dimethylpiperazin-1-yl)acetyl]-methylamino]phenyl]-1-phenylethylidene]-2-oxo-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 158726760 |
| Molecular Formula | C33H36N4O4 |
| Molecular Weight | 559.72 g/mol |
| Exact Mass | 559.32 |
| IUPAC Name | methyl (3E)-3-[2-[4-[[2-(2,2,3,3,5,6,6-heptadeuterio-4,5-dimethylpiperazin-1-yl)acetyl]-methylamino]phenyl]-1-phenylethylidene]-2-oxo-1H-indole-6-carboxylate |
| SMILES | [2H]C1([2H])N(CC(=O)N(C)c2ccc(C/C(=C3\C(=O)Nc4cc(C(=O)OC)ccc43)c3ccccc3)cc2)C([2H])([2H])C([2H])(C)N(C)C1([2H])[2H] |
| InChI | InChI=1S/C33H36N4O4/c1-22-20-37(17-16-35(22)2)21-30(38)36(3)26-13-10-23(11-14-26)18-28(24-8-6-5-7-9-24)31-27-15-12-25(33(40)41-4)19-29(27)34-32(31)39/h5-15,19,22H,16-18,20-21H2,1-4H3,(H,34,39)/b31-28+/i16D2,17D2,20D2,22D |
| InChIKey | QERSXALAQKDKEV-AFAMJMIYSA-N |
| XLogP | 4.18 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.72 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|