C37H43N7O6 — CID 158371054
methyl (1Z)-1-[[4-[[2-[4-[2-[2-(2-azidoethoxy)ethoxy]ethyl]piperazin-1-yl]acetyl]-methylamino]anilino]-phenylmethylidene]-2-oxo-3H-indene-5-carboxylate (PubChem CID 158371054) has the molecular formula C37H43N7O6 and a molecular weight of 681.79 g/mol. Its IUPAC name is methyl (1Z)-1-[[4-[[2-[4-[2-[2-(2-azidoethoxy)ethoxy]ethyl]piperazin-1-yl]acetyl]-methylamino]anilino]-phenylmethylidene]-2-oxo-3H-indene-5-carboxylate.
| Compound Name | methyl (1Z)-1-[[4-[[2-[4-[2-[2-(2-azidoethoxy)ethoxy]ethyl]piperazin-1-yl]acetyl]-methylamino]anilino]-phenylmethylidene]-2-oxo-3H-indene-5-carboxylate |
|---|---|
| PubChem CID | 158371054 |
| Molecular Formula | C37H43N7O6 |
| Molecular Weight | 681.79 g/mol |
| Exact Mass | 681.33 |
| IUPAC Name | methyl (1Z)-1-[[4-[[2-[4-[2-[2-(2-azidoethoxy)ethoxy]ethyl]piperazin-1-yl]acetyl]-methylamino]anilino]-phenylmethylidene]-2-oxo-3H-indene-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CC(=O)/C2=C(\Nc1ccc(N(C)C(=O)CN2CCN(CCOCCOCCN=[N+]=[N-])CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C37H43N7O6/c1-42(34(46)26-44-17-15-43(16-18-44)19-21-50-23-22-49-20-14-39-41-38)31-11-9-30(10-12-31)40-36(27-6-4-3-5-7-27)35-32-13-8-28(37(47)48-2)24-29(32)25-33(35)45/h3-13,24,40H,14-23,25-26H2,1-2H3/b36-35- |
| InChIKey | CHUARBMVYIRRCX-KXYMVQBMSA-N |
| XLogP | 4.50 |
| TPSA | 149.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.79 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|