C27H24O6S — CID 158276596
(E)-3-[4-[[6-methoxy-2-(4-methoxyphenyl)-1-oxo-1-benzothiophen-3-yl]oxy]phenyl]-2-methylbut-2-enoic acid (PubChem CID 158276596) has the molecular formula C27H24O6S and a molecular weight of 476.55 g/mol. Its IUPAC name is (E)-3-[4-[[6-methoxy-2-(4-methoxyphenyl)-1-oxo-1-benzothiophen-3-yl]oxy]phenyl]-2-methylbut-2-enoic acid.
| Compound Name | (E)-3-[4-[[6-methoxy-2-(4-methoxyphenyl)-1-oxo-1-benzothiophen-3-yl]oxy]phenyl]-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 158276596 |
| Molecular Formula | C27H24O6S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | (E)-3-[4-[[6-methoxy-2-(4-methoxyphenyl)-1-oxo-1-benzothiophen-3-yl]oxy]phenyl]-2-methylbut-2-enoic acid |
| SMILES | COc1ccc(C2=C(Oc3ccc(/C(C)=C(\C)C(=O)O)cc3)c3ccc(OC)cc3S2=O)cc1 |
| InChI | InChI=1S/C27H24O6S/c1-16(17(2)27(28)29)18-5-11-21(12-6-18)33-25-23-14-13-22(32-4)15-24(23)34(30)26(25)19-7-9-20(31-3)10-8-19/h5-15H,1-4H3,(H,28,29)/b17-16+ |
| InChIKey | GJRKELADYWDANR-WUKNDPDISA-N |
| XLogP | 5.61 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|