C37H28BrNO6 — CID 158279054
2-(bromomethyl)indene-1,3-dione;2,3-dihydroinden-1-one;2-[(3-oxo-1,2-dihydroinden-2-yl)methyl]isoindole-1,3-dione (PubChem CID 158279054) has the molecular formula C37H28BrNO6 and a molecular weight of 662.54 g/mol. Its IUPAC name is 2-(bromomethyl)indene-1,3-dione;2,3-dihydroinden-1-one;2-[(3-oxo-1,2-dihydroinden-2-yl)methyl]isoindole-1,3-dione.
| Compound Name | 2-(bromomethyl)indene-1,3-dione;2,3-dihydroinden-1-one;2-[(3-oxo-1,2-dihydroinden-2-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 158279054 |
| Molecular Formula | C37H28BrNO6 |
| Molecular Weight | 662.54 g/mol |
| Exact Mass | 661.11 |
| IUPAC Name | 2-(bromomethyl)indene-1,3-dione;2,3-dihydroinden-1-one;2-[(3-oxo-1,2-dihydroinden-2-yl)methyl]isoindole-1,3-dione |
| SMILES | O=C1CCc2ccccc21.O=C1c2ccccc2C(=O)C1CBr.O=C1c2ccccc2CC1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H13NO3.C10H7BrO2.C9H8O/c20-16-12(9-11-5-1-2-6-13(11)16)10-19-17(21)14-7-3-4-8-15(14)18(19)22;11-5-8-9(12)6-3-1-2-4-7(6)10(8)13;10-9-6-5-7-3-1-2-4-8(7)9/h1-8,12H,9-10H2;1-4,8H,5H2;1-4H,5-6H2 |
| InChIKey | GJZDPYOJTQCUJM-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 105.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.54 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|