C43H57N3O7 — CID 158280844
tert-butyl N-[(3S,6S)-6-[[(3S)-3-methyl-2-oxopentyl]carbamoyl]-2-[(2-methylpropan-2-yl)oxy]-4,8-dioxo-8-(tritylamino)octan-3-yl]carbamate (PubChem CID 158280844) has the molecular formula C43H57N3O7 and a molecular weight of 727.94 g/mol. Its IUPAC name is tert-butyl N-[(3S,6S)-6-[[(3S)-3-methyl-2-oxopentyl]carbamoyl]-2-[(2-methylpropan-2-yl)oxy]-4,8-dioxo-8-(tritylamino)octan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,6S)-6-[[(3S)-3-methyl-2-oxopentyl]carbamoyl]-2-[(2-methylpropan-2-yl)oxy]-4,8-dioxo-8-(tritylamino)octan-3-yl]carbamate |
|---|---|
| PubChem CID | 158280844 |
| Molecular Formula | C43H57N3O7 |
| Molecular Weight | 727.94 g/mol |
| Exact Mass | 727.42 |
| IUPAC Name | tert-butyl N-[(3S,6S)-6-[[(3S)-3-methyl-2-oxopentyl]carbamoyl]-2-[(2-methylpropan-2-yl)oxy]-4,8-dioxo-8-(tritylamino)octan-3-yl]carbamate |
| SMILES | CC[C@H](C)C(=O)CNC(=O)[C@H](CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)CC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)OC(C)(C)C |
| InChI | InChI=1S/C43H57N3O7/c1-10-29(2)36(48)28-44-39(50)31(26-35(47)38(30(3)52-41(4,5)6)45-40(51)53-42(7,8)9)27-37(49)46-43(32-20-14-11-15-21-32,33-22-16-12-17-23-33)34-24-18-13-19-25-34/h11-25,29-31,38H,10,26-28H2,1-9H3,(H,44,50)(H,45,51)(H,46,49)/t29-,30?,31-,38-/m0/s1 |
| InChIKey | SQBSCZOGVADFBV-JZUIVSLTSA-N |
| XLogP | 6.89 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.94 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|