C37H52N4O9 — CID 158283747
[4-[(3S)-8-amino-3-[[(2S,5S)-5-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-4-oxo-2-propan-2-yloctanoyl]amino]-2,8-dioxooctyl]phenyl]methyl 2,2-dimethylpropanoate (PubChem CID 158283747) has the molecular formula C37H52N4O9 and a molecular weight of 696.84 g/mol. Its IUPAC name is [4-[(3S)-8-amino-3-[[(2S,5S)-5-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-4-oxo-2-propan-2-yloctanoyl]amino]-2,8-dioxooctyl]phenyl]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[(3S)-8-amino-3-[[(2S,5S)-5-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-4-oxo-2-propan-2-yloctanoyl]amino]-2,8-dioxooctyl]phenyl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 158283747 |
| Molecular Formula | C37H52N4O9 |
| Molecular Weight | 696.84 g/mol |
| Exact Mass | 696.37 |
| IUPAC Name | [4-[(3S)-8-amino-3-[[(2S,5S)-5-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-4-oxo-2-propan-2-yloctanoyl]amino]-2,8-dioxooctyl]phenyl]methyl 2,2-dimethylpropanoate |
| SMILES | CCC[C@H](NC(=O)CN1C(=O)C=CC1=O)C(=O)C[C@H](C(=O)N[C@@H](CCCCC(N)=O)C(=O)Cc1ccc(COC(=O)C(C)(C)C)cc1)C(C)C |
| InChI | InChI=1S/C37H52N4O9/c1-7-10-27(39-32(45)21-41-33(46)17-18-34(41)47)30(43)20-26(23(2)3)35(48)40-28(11-8-9-12-31(38)44)29(42)19-24-13-15-25(16-14-24)22-50-36(49)37(4,5)6/h13-18,23,26-28H,7-12,19-22H2,1-6H3,(H2,38,44)(H,39,45)(H,40,48)/t26-,27-,28-/m0/s1 |
| InChIKey | FTSNMTHRFFIAEF-KCHLEUMXSA-N |
| XLogP | 2.86 |
| TPSA | 199.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.84 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|