C29H21FN6O10S2 — CID 158286386
3-cyano-N-(2-fluoro-5-nitrophenyl)benzenesulfonamide;3-[[(2R)-2-(hydroxymethyl)-6-nitro-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonyl]benzonitrile (PubChem CID 158286386) has the molecular formula C29H21FN6O10S2 and a molecular weight of 696.65 g/mol. Its IUPAC name is 3-cyano-N-(2-fluoro-5-nitrophenyl)benzenesulfonamide;3-[[(2R)-2-(hydroxymethyl)-6-nitro-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonyl]benzonitrile.
| Compound Name | 3-cyano-N-(2-fluoro-5-nitrophenyl)benzenesulfonamide;3-[[(2R)-2-(hydroxymethyl)-6-nitro-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonyl]benzonitrile |
|---|---|
| PubChem CID | 158286386 |
| Molecular Formula | C29H21FN6O10S2 |
| Molecular Weight | 696.65 g/mol |
| Exact Mass | 696.07 |
| IUPAC Name | 3-cyano-N-(2-fluoro-5-nitrophenyl)benzenesulfonamide;3-[[(2R)-2-(hydroxymethyl)-6-nitro-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonyl]benzonitrile |
| SMILES | N#Cc1cccc(S(=O)(=O)N2C[C@H](CO)Oc3ccc([N+](=O)[O-])cc32)c1.N#Cc1cccc(S(=O)(=O)Nc2cc([N+](=O)[O-])ccc2F)c1 |
| InChI | InChI=1S/C16H13N3O6S.C13H8FN3O4S/c17-8-11-2-1-3-14(6-11)26(23,24)18-9-13(10-20)25-16-5-4-12(19(21)22)7-15(16)18;14-12-5-4-10(17(18)19)7-13(12)16-22(20,21)11-3-1-2-9(6-11)8-15/h1-7,13,20H,9-10H2;1-7,16H/t13-;/m1./s1 |
| InChIKey | GKVGOMNEYOJUIG-BTQNPOSSSA-N |
| XLogP | 3.82 |
| TPSA | 246.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.65 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|