methyl 4-chloro-9H-indeno[2,1-d]pyrimidine-7-carboxylate

C13H9ClN2O2 — CID 158287878

IUPACmethyl 4-chloro-9H-indeno[2,1-d]pyrimidine-7-carboxylate
SMILESCOC(=O)c1ccc2c(c1)Cc1ncnc(Cl)c1-2
InChIInChI=1S/C13H9ClN2O2/c1-18-13(17)7-2-3-9-8(4-7)5-10-11(9)12(14)16-6-15-10/h2-4,6H,5H2,1H3
InChIKeyGKZSPOQGHIUTFD-UHFFFAOYSA-N
MW260.68 g/mol
LogP2.49
Rot. Bonds1

About methyl 4-chloro-9H-indeno[2,1-d]pyrimidine-7-carboxylate

methyl 4-chloro-9H-indeno[2,1-d]pyrimidine-7-carboxylate (PubChem CID 158287878) has the molecular formula C13H9ClN2O2 and a molecular weight of 260.68 g/mol. Its IUPAC name is methyl 4-chloro-9H-indeno[2,1-d]pyrimidine-7-carboxylate.

Molecular Properties

Compound Namemethyl 4-chloro-9H-indeno[2,1-d]pyrimidine-7-carboxylate
PubChem CID158287878
Molecular FormulaC13H9ClN2O2
Molecular Weight260.68 g/mol
Exact Mass260.04
IUPAC Namemethyl 4-chloro-9H-indeno[2,1-d]pyrimidine-7-carboxylate
SMILESCOC(=O)c1ccc2c(c1)Cc1ncnc(Cl)c1-2
InChIInChI=1S/C13H9ClN2O2/c1-18-13(17)7-2-3-9-8(4-7)5-10-11(9)12(14)16-6-15-10/h2-4,6H,5H2,1H3
InChIKeyGKZSPOQGHIUTFD-UHFFFAOYSA-N
XLogP2.49
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.68
LogP ≤ 52.49
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 4-chloro-9H-indeno[2,1-d]pyrimidine-7-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-chloro-9H-indeno[2,1-d]pyrimidine-7-carboxylate?
The IUPAC name of methyl 4-chloro-9H-indeno[2,1-d]pyrimidine-7-carboxylate (CID 158287878) is methyl 4-chloro-9H-indeno[2,1-d]pyrimidine-7-carboxylate.
What is the SMILES notation for methyl 4-chloro-9H-indeno[2,1-d]pyrimidine-7-carboxylate?
The canonical SMILES for methyl 4-chloro-9H-indeno[2,1-d]pyrimidine-7-carboxylate is COC(=O)c1ccc2c(c1)Cc1ncnc(Cl)c1-2.
What is the InChIKey of methyl 4-chloro-9H-indeno[2,1-d]pyrimidine-7-carboxylate?
The InChIKey is GKZSPOQGHIUTFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClN2O2/c1-18-13(17)7-2-3-9-8(4-7)5-10-11(9)12(14)16-6-15-10/h2-4,6H,5H2,1H3.
What are the key properties of methyl 4-chloro-9H-indeno[2,1-d]pyrimidine-7-carboxylate?
methyl 4-chloro-9H-indeno[2,1-d]pyrimidine-7-carboxylate has a molecular weight of 260.68 g/mol, XLogP of 2.49, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-chloro-9H-indeno[2,1-d]pyrimidine-7-carboxylate is sourced from PubChem (CID 158287878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).