C13H9ClN2O2 — CID 158287878
methyl 4-chloro-9H-indeno[2,1-d]pyrimidine-7-carboxylate (PubChem CID 158287878) has the molecular formula C13H9ClN2O2 and a molecular weight of 260.68 g/mol. Its IUPAC name is methyl 4-chloro-9H-indeno[2,1-d]pyrimidine-7-carboxylate.
| Compound Name | methyl 4-chloro-9H-indeno[2,1-d]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 158287878 |
| Molecular Formula | C13H9ClN2O2 |
| Molecular Weight | 260.68 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | methyl 4-chloro-9H-indeno[2,1-d]pyrimidine-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)Cc1ncnc(Cl)c1-2 |
| InChI | InChI=1S/C13H9ClN2O2/c1-18-13(17)7-2-3-9-8(4-7)5-10-11(9)12(14)16-6-15-10/h2-4,6H,5H2,1H3 |
| InChIKey | GKZSPOQGHIUTFD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.68 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |