C19H18O5S2 — CID 15828866
(1S,4R,5R,6R)-5,6-bis(benzenesulfonyl)-1-methyl-7-oxabicyclo[2.2.1]hept-2-ene (PubChem CID 15828866) has the molecular formula C19H18O5S2 and a molecular weight of 390.48 g/mol. Its IUPAC name is (1S,4R,5R,6R)-5,6-bis(benzenesulfonyl)-1-methyl-7-oxabicyclo[2.2.1]hept-2-ene.
| Compound Name | (1S,4R,5R,6R)-5,6-bis(benzenesulfonyl)-1-methyl-7-oxabicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 15828866 |
| Molecular Formula | C19H18O5S2 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | (1S,4R,5R,6R)-5,6-bis(benzenesulfonyl)-1-methyl-7-oxabicyclo[2.2.1]hept-2-ene |
| SMILES | C[C@@]12C=C[C@@H](O1)[C@@H](S(=O)(=O)c1ccccc1)[C@@H]2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18O5S2/c1-19-13-12-16(24-19)17(25(20,21)14-8-4-2-5-9-14)18(19)26(22,23)15-10-6-3-7-11-15/h2-13,16-18H,1H3/t16-,17-,18+,19+/m1/s1 |
| InChIKey | DDXVNHFSWUEQAV-YRXWBPOGSA-N |
| XLogP | 2.40 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|