C31H49N9O13 — CID 158292514
(2S)-2-amino-6-(4-azidobutanoyloxy)hexanoic acid;1-azidopropane;(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(4-nitrophenoxy)carbonyloxyhexanoic acid (PubChem CID 158292514) has the molecular formula C31H49N9O13 and a molecular weight of 755.78 g/mol. Its IUPAC name is (2S)-2-amino-6-(4-azidobutanoyloxy)hexanoic acid;1-azidopropane;(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(4-nitrophenoxy)carbonyloxyhexanoic acid.
| Compound Name | (2S)-2-amino-6-(4-azidobutanoyloxy)hexanoic acid;1-azidopropane;(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(4-nitrophenoxy)carbonyloxyhexanoic acid |
|---|---|
| PubChem CID | 158292514 |
| Molecular Formula | C31H49N9O13 |
| Molecular Weight | 755.78 g/mol |
| Exact Mass | 755.34 |
| IUPAC Name | (2S)-2-amino-6-(4-azidobutanoyloxy)hexanoic acid;1-azidopropane;(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(4-nitrophenoxy)carbonyloxyhexanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCOC(=O)Oc1ccc([N+](=O)[O-])cc1)C(=O)O.CCCN=[N+]=[N-].[N-]=[N+]=NCCCC(=O)OCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C18H24N2O9.C10H18N4O4.C3H7N3/c1-18(2,3)29-16(23)19-14(15(21)22)6-4-5-11-27-17(24)28-13-9-7-12(8-10-13)20(25)26;11-8(10(16)17)4-1-2-7-18-9(15)5-3-6-13-14-12;1-2-3-5-6-4/h7-10,14H,4-6,11H2,1-3H3,(H,19,23)(H,21,22);8H,1-7,11H2,(H,16,17);2-3H2,1H3/t14-;8-;/m00./s1 |
| InChIKey | GLNLHSLSIYPEAA-SFFVXIAHSA-N |
| XLogP | 6.17 |
| TPSA | 341.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.78 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|