C46H28O7 — CID 158300608
10-phenyl-9-(15-phenyl-12-oxapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-9-yl)anthracene-1,2,4,5,7,8-hexol (PubChem CID 158300608) has the molecular formula C46H28O7 and a molecular weight of 692.72 g/mol. Its IUPAC name is 10-phenyl-9-(15-phenyl-12-oxapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-9-yl)anthracene-1,2,4,5,7,8-hexol.
| Compound Name | 10-phenyl-9-(15-phenyl-12-oxapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-9-yl)anthracene-1,2,4,5,7,8-hexol |
|---|---|
| PubChem CID | 158300608 |
| Molecular Formula | C46H28O7 |
| Molecular Weight | 692.72 g/mol |
| Exact Mass | 692.18 |
| IUPAC Name | 10-phenyl-9-(15-phenyl-12-oxapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-9-yl)anthracene-1,2,4,5,7,8-hexol |
| SMILES | Oc1cc(O)c2c(-c3ccccc3)c3c(O)cc(O)c(O)c3c(-c3cc4oc5cc(-c6ccccc6)c6ccccc6c5c4c4ccccc34)c2c1O |
| InChI | InChI=1S/C46H28O7/c47-31-21-33(49)45(51)43-40(44-42(32(48)22-34(50)46(44)52)37(41(31)43)24-13-5-2-6-14-24)30-20-36-39(28-18-10-8-16-26(28)30)38-27-17-9-7-15-25(27)29(19-35(38)53-36)23-11-3-1-4-12-23/h1-22,47-52H |
| InChIKey | GGMNXMSHMZDZFA-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.72 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|