About aluminum;3-fluorophenolate;bis(trifluoromethanesulfonate)
aluminum;3-fluorophenolate;bis(trifluoromethanesulfonate) (PubChem CID 158327845) has the molecular formula C8H4AlF7O7S2
and a molecular weight of 436.22 g/mol. Its IUPAC name is aluminum;3-fluorophenolate;bis(trifluoromethanesulfonate).
Molecular Properties
| Compound Name | aluminum;3-fluorophenolate;bis(trifluoromethanesulfonate) |
| PubChem CID | 158327845 |
| Molecular Formula | C8H4AlF7O7S2 |
| Molecular Weight | 436.22 g/mol |
| Exact Mass | 435.91 |
| IUPAC Name | aluminum;3-fluorophenolate;bis(trifluoromethanesulfonate) |
| SMILES | O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.[Al+3].[O-]c1cccc(F)c1 |
| InChI | InChI=1S/C6H5FO.2CHF3O3S.Al/c7-5-2-1-3-6(8)4-5;2*2-1(3,4)8(5,6)7;/h1-4,8H;2*(H,5,6,7);/q;;;+3/p-3 |
| InChIKey | GPQAUGOOKNFUAQ-UHFFFAOYSA-K |
| XLogP | 0.62 |
| TPSA | 137.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.22 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze aluminum;3-fluorophenolate;bis(trifluoromethanesulfonate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum;3-fluorophenolate;bis(trifluoromethanesulfonate)?
The IUPAC name of aluminum;3-fluorophenolate;bis(trifluoromethanesulfonate) (CID 158327845) is aluminum;3-fluorophenolate;bis(trifluoromethanesulfonate).
What is the SMILES notation for aluminum;3-fluorophenolate;bis(trifluoromethanesulfonate)?
The canonical SMILES for aluminum;3-fluorophenolate;bis(trifluoromethanesulfonate) is O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.[Al+3].[O-]c1cccc(F)c1.
What is the InChIKey of aluminum;3-fluorophenolate;bis(trifluoromethanesulfonate)?
The InChIKey is GPQAUGOOKNFUAQ-UHFFFAOYSA-K. The full InChI is InChI=1S/C6H5FO.2CHF3O3S.Al/c7-5-2-1-3-6(8)4-5;2*2-1(3,4)8(5,6)7;/h1-4,8H;2*(H,5,6,7);/q;;;+3/p-3.
What are the key properties of aluminum;3-fluorophenolate;bis(trifluoromethanesulfonate)?
aluminum;3-fluorophenolate;bis(trifluoromethanesulfonate) has a molecular weight of 436.22 g/mol, XLogP of 0.62, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum;3-fluorophenolate;bis(trifluoromethanesulfonate) is sourced from PubChem (CID 158327845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).