C17H20ClN3O4 — CID 15833242
dipropan-2-yl 5-amino-1-(4-chlorophenyl)pyrazole-3,4-dicarboxylate (PubChem CID 15833242) has the molecular formula C17H20ClN3O4 and a molecular weight of 365.82 g/mol. Its IUPAC name is dipropan-2-yl 5-amino-1-(4-chlorophenyl)pyrazole-3,4-dicarboxylate.
| Compound Name | dipropan-2-yl 5-amino-1-(4-chlorophenyl)pyrazole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 15833242 |
| Molecular Formula | C17H20ClN3O4 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | dipropan-2-yl 5-amino-1-(4-chlorophenyl)pyrazole-3,4-dicarboxylate |
| SMILES | CC(C)OC(=O)c1nn(-c2ccc(Cl)cc2)c(N)c1C(=O)OC(C)C |
| InChI | InChI=1S/C17H20ClN3O4/c1-9(2)24-16(22)13-14(17(23)25-10(3)4)20-21(15(13)19)12-7-5-11(18)6-8-12/h5-10H,19H2,1-4H3 |
| InChIKey | SJKVQMKENICJCQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |