C18H21N3O6 — CID 52911785
dimethyl 5-(5-amino-3-methyl-4-propan-2-yloxycarbonylpyrazol-1-yl)benzene-1,3-dicarboxylate (PubChem CID 52911785) has the molecular formula C18H21N3O6 and a molecular weight of 375.38 g/mol. Its IUPAC name is dimethyl 5-(5-amino-3-methyl-4-propan-2-yloxycarbonylpyrazol-1-yl)benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-(5-amino-3-methyl-4-propan-2-yloxycarbonylpyrazol-1-yl)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 52911785 |
| Molecular Formula | C18H21N3O6 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | dimethyl 5-(5-amino-3-methyl-4-propan-2-yloxycarbonylpyrazol-1-yl)benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(-n2nc(C)c(C(=O)OC(C)C)c2N)c1 |
| InChI | InChI=1S/C18H21N3O6/c1-9(2)27-18(24)14-10(3)20-21(15(14)19)13-7-11(16(22)25-4)6-12(8-13)17(23)26-5/h6-9H,19H2,1-5H3 |
| InChIKey | JCHXSGZDOXRPDU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|