C11H18O2 — CID 15833764
(1S,5R,9S)-12-oxatricyclo[7.2.1.01,5]dodecan-9-ol (PubChem CID 15833764) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (1S,5R,9S)-12-oxatricyclo[7.2.1.01,5]dodecan-9-ol.
| Compound Name | (1S,5R,9S)-12-oxatricyclo[7.2.1.01,5]dodecan-9-ol |
|---|---|
| PubChem CID | 15833764 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (1S,5R,9S)-12-oxatricyclo[7.2.1.01,5]dodecan-9-ol |
| SMILES | O[C@]12CCC[C@H]3CCC[C@@]3(CC1)O2 |
| InChI | InChI=1S/C11H18O2/c12-11-6-2-4-9-3-1-5-10(9,13-11)7-8-11/h9,12H,1-8H2/t9-,10+,11+/m1/s1 |
| InChIKey | GVLVVGJTRDUSDE-VWYCJHECSA-N |
| XLogP | 2.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |