C12H20O — CID 23327517
(1S,5R,8R)-10-methyl-12-oxatricyclo[6.3.1.01,5]dodecane (PubChem CID 23327517) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (1S,5R,8R)-10-methyl-12-oxatricyclo[6.3.1.01,5]dodecane.
| Compound Name | (1S,5R,8R)-10-methyl-12-oxatricyclo[6.3.1.01,5]dodecane |
|---|---|
| PubChem CID | 23327517 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (1S,5R,8R)-10-methyl-12-oxatricyclo[6.3.1.01,5]dodecane |
| SMILES | CC1C[C@H]2CC[C@H]3CCC[C@@]3(C1)O2 |
| InChI | InChI=1S/C12H20O/c1-9-7-11-5-4-10-3-2-6-12(10,8-9)13-11/h9-11H,2-8H2,1H3/t9?,10-,11-,12+/m1/s1 |
| InChIKey | KCXXJHOYURZMHN-RDFFEMEHSA-N |
| XLogP | 3.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |