C24H24F3O4S+ — CID 158339512
bis(4-ethoxyphenyl)sulfanium;phenyl 2,2,2-trifluoroacetate (PubChem CID 158339512) has the molecular formula C24H24F3O4S+ and a molecular weight of 465.51 g/mol. Its IUPAC name is bis(4-ethoxyphenyl)sulfanium;phenyl 2,2,2-trifluoroacetate.
| Compound Name | bis(4-ethoxyphenyl)sulfanium;phenyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 158339512 |
| Molecular Formula | C24H24F3O4S+ |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | bis(4-ethoxyphenyl)sulfanium;phenyl 2,2,2-trifluoroacetate |
| SMILES | CCOc1ccc([SH+]c2ccc(OCC)cc2)cc1.O=C(Oc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H18O2S.C8H5F3O2/c1-3-17-13-5-9-15(10-6-13)19-16-11-7-14(8-12-16)18-4-2;9-8(10,11)7(12)13-6-4-2-1-3-5-6/h5-12H,3-4H2,1-2H3;1-5H/p+1 |
| InChIKey | GQZHGCUJFHFHGV-UHFFFAOYSA-O |
| XLogP | 5.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|