C33H37F2O2S+ — CID 158365389
2,2-difluoropropyl adamantane-1-carboxylate;(4-methylphenyl)-diphenylsulfanium (PubChem CID 158365389) has the molecular formula C33H37F2O2S+ and a molecular weight of 535.72 g/mol. Its IUPAC name is 2,2-difluoropropyl adamantane-1-carboxylate;(4-methylphenyl)-diphenylsulfanium.
| Compound Name | 2,2-difluoropropyl adamantane-1-carboxylate;(4-methylphenyl)-diphenylsulfanium |
|---|---|
| PubChem CID | 158365389 |
| Molecular Formula | C33H37F2O2S+ |
| Molecular Weight | 535.72 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | 2,2-difluoropropyl adamantane-1-carboxylate;(4-methylphenyl)-diphenylsulfanium |
| SMILES | CC(F)(F)COC(=O)C12CC3CC(CC(C3)C1)C2.Cc1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H17S.C14H20F2O2/c1-16-12-14-19(15-13-16)20(17-8-4-2-5-9-17)18-10-6-3-7-11-18;1-13(15,16)8-18-12(17)14-5-9-2-10(6-14)4-11(3-9)7-14/h2-15H,1H3;9-11H,2-8H2,1H3/q+1; |
| InChIKey | GTYUWQCLESMOPH-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.72 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|