C4H8N2 — CID 15839088
1,3-diazabicyclo[2.2.0]hexane (PubChem CID 15839088) has the molecular formula C4H8N2 and a molecular weight of 84.12 g/mol. Its IUPAC name is 1,3-diazabicyclo[2.2.0]hexane.
| Compound Name | 1,3-diazabicyclo[2.2.0]hexane |
|---|---|
| PubChem CID | 15839088 |
| Molecular Formula | C4H8N2 |
| Molecular Weight | 84.12 g/mol |
| Exact Mass | 84.07 |
| IUPAC Name | 1,3-diazabicyclo[2.2.0]hexane |
| SMILES | C1CN2CNC12 |
| InChI | InChI=1S/C4H8N2/c1-2-6-3-5-4(1)6/h4-5H,1-3H2 |
| InChIKey | DDFSSOQYYJAGAO-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 84.12 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |