C11H24N4 — CID 163677810
1,6-dimethyl-4-(4-methylpiperazin-1-yl)-1,3-diazinane (PubChem CID 163677810) has the molecular formula C11H24N4 and a molecular weight of 212.34 g/mol. Its IUPAC name is 1,6-dimethyl-4-(4-methylpiperazin-1-yl)-1,3-diazinane.
| Compound Name | 1,6-dimethyl-4-(4-methylpiperazin-1-yl)-1,3-diazinane |
|---|---|
| PubChem CID | 163677810 |
| Molecular Formula | C11H24N4 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.20 |
| IUPAC Name | 1,6-dimethyl-4-(4-methylpiperazin-1-yl)-1,3-diazinane |
| SMILES | CC1CC(N2CCN(C)CC2)NCN1C |
| InChI | InChI=1S/C11H24N4/c1-10-8-11(12-9-14(10)3)15-6-4-13(2)5-7-15/h10-12H,4-9H2,1-3H3 |
| InChIKey | JIFJASOQXBPKBJ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |