C16H36N8O2 — CID 158397719
N-(2-aminoethyl)-2-(4-methylpiperazin-1-yl)acetamide;2-(4-methylpiperazin-1-yl)acetohydrazide (PubChem CID 158397719) has the molecular formula C16H36N8O2 and a molecular weight of 372.52 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-(4-methylpiperazin-1-yl)acetamide;2-(4-methylpiperazin-1-yl)acetohydrazide.
| Compound Name | N-(2-aminoethyl)-2-(4-methylpiperazin-1-yl)acetamide;2-(4-methylpiperazin-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 158397719 |
| Molecular Formula | C16H36N8O2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | N-(2-aminoethyl)-2-(4-methylpiperazin-1-yl)acetamide;2-(4-methylpiperazin-1-yl)acetohydrazide |
| SMILES | CN1CCN(CC(=O)NCCN)CC1.CN1CCN(CC(=O)NN)CC1 |
| InChI | InChI=1S/C9H20N4O.C7H16N4O/c1-12-4-6-13(7-5-12)8-9(14)11-3-2-10;1-10-2-4-11(5-3-10)6-7(12)9-8/h2-8,10H2,1H3,(H,11,14);2-6,8H2,1H3,(H,9,12) |
| InChIKey | GXSIBENXBRPFFU-UHFFFAOYSA-N |
| XLogP | -3.47 |
| TPSA | 123.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | -3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|