C16H36N8O2 — CID 159081191
N'-methyl-2-(4-methylpiperazin-1-yl)acetohydrazide (PubChem CID 159081191) has the molecular formula C16H36N8O2 and a molecular weight of 372.52 g/mol. Its IUPAC name is N'-methyl-2-(4-methylpiperazin-1-yl)acetohydrazide.
| Compound Name | N'-methyl-2-(4-methylpiperazin-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 159081191 |
| Molecular Formula | C16H36N8O2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | N'-methyl-2-(4-methylpiperazin-1-yl)acetohydrazide |
| SMILES | CNNC(=O)CN1CCN(C)CC1.CNNC(=O)CN1CCN(C)CC1 |
| InChI | InChI=1S/2C8H18N4O/c2*1-9-10-8(13)7-12-5-3-11(2)4-6-12/h2*9H,3-7H2,1-2H3,(H,10,13) |
| InChIKey | KAWJWLLMVYDVOM-UHFFFAOYSA-N |
| XLogP | -3.03 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|