C16H26N2O4 — CID 158403169
[(1S,2E,6S)-6-methyl-6-(morpholine-4-carbonyl)cyclooct-2-en-1-yl] N-methylcarbamate (PubChem CID 158403169) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is [(1S,2E,6S)-6-methyl-6-(morpholine-4-carbonyl)cyclooct-2-en-1-yl] N-methylcarbamate.
| Compound Name | [(1S,2E,6S)-6-methyl-6-(morpholine-4-carbonyl)cyclooct-2-en-1-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 158403169 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | [(1S,2E,6S)-6-methyl-6-(morpholine-4-carbonyl)cyclooct-2-en-1-yl] N-methylcarbamate |
| SMILES | CNC(=O)O[C@@H]1/C=C\CC[C@](C)(C(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C16H26N2O4/c1-16(14(19)18-9-11-21-12-10-18)7-4-3-5-13(6-8-16)22-15(20)17-2/h3,5,13H,4,6-12H2,1-2H3,(H,17,20)/b5-3-/t13-,16+/m1/s1 |
| InChIKey | GYIVCNNRDRATPB-ILVPNPQQSA-N |
| XLogP | 1.71 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|