C21H30N2O9 — CID 170135254
[methyl(4-oxobutanoyl)amino] (1S,4E)-1-methyl-6-[methyl(4-oxobutanoyl)amino]oxycarbonyloxycyclooct-4-ene-1-carboxylate (PubChem CID 170135254) has the molecular formula C21H30N2O9 and a molecular weight of 454.48 g/mol. Its IUPAC name is [methyl(4-oxobutanoyl)amino] (1S,4E)-1-methyl-6-[methyl(4-oxobutanoyl)amino]oxycarbonyloxycyclooct-4-ene-1-carboxylate.
| Compound Name | [methyl(4-oxobutanoyl)amino] (1S,4E)-1-methyl-6-[methyl(4-oxobutanoyl)amino]oxycarbonyloxycyclooct-4-ene-1-carboxylate |
|---|---|
| PubChem CID | 170135254 |
| Molecular Formula | C21H30N2O9 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | [methyl(4-oxobutanoyl)amino] (1S,4E)-1-methyl-6-[methyl(4-oxobutanoyl)amino]oxycarbonyloxycyclooct-4-ene-1-carboxylate |
| SMILES | CN(OC(=O)OC1/C=C\CC[C@](C)(C(=O)ON(C)C(=O)CCC=O)CC1)C(=O)CCC=O |
| InChI | InChI=1S/C21H30N2O9/c1-21(19(28)31-22(2)17(26)9-6-14-24)12-5-4-8-16(11-13-21)30-20(29)32-23(3)18(27)10-7-15-25/h4,8,14-16H,5-7,9-13H2,1-3H3/b8-4-/t16?,21-/m0/s1 |
| InChIKey | YGGXTRLAPLRSFF-VXRUDNEASA-N |
| XLogP | 1.89 |
| TPSA | 136.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|