C21H48O6Si2 — CID 158409158
trimethoxy-[6,6,8,8-tetramethyl-4-(2-trimethoxysilylethyl)nonyl]silane (PubChem CID 158409158) has the molecular formula C21H48O6Si2 and a molecular weight of 452.78 g/mol. Its IUPAC name is trimethoxy-[6,6,8,8-tetramethyl-4-(2-trimethoxysilylethyl)nonyl]silane.
| Compound Name | trimethoxy-[6,6,8,8-tetramethyl-4-(2-trimethoxysilylethyl)nonyl]silane |
|---|---|
| PubChem CID | 158409158 |
| Molecular Formula | C21H48O6Si2 |
| Molecular Weight | 452.78 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | trimethoxy-[6,6,8,8-tetramethyl-4-(2-trimethoxysilylethyl)nonyl]silane |
| SMILES | CO[Si](CCCC(CC[Si](OC)(OC)OC)CC(C)(C)CC(C)(C)C)(OC)OC |
| InChI | InChI=1S/C21H48O6Si2/c1-20(2,3)18-21(4,5)17-19(14-16-29(25-9,26-10)27-11)13-12-15-28(22-6,23-7)24-8/h19H,12-18H2,1-11H3 |
| InChIKey | MDHCDVKOIYPUDA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.78 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|