About N-methylpropan-2-amine;1-propyl-2-tetradecylbenzene
N-methylpropan-2-amine;1-propyl-2-tetradecylbenzene (PubChem CID 158412093) has the molecular formula C27H51N
and a molecular weight of 389.71 g/mol. Its IUPAC name is N-methylpropan-2-amine;1-propyl-2-tetradecylbenzene.
Molecular Properties
| Compound Name | N-methylpropan-2-amine;1-propyl-2-tetradecylbenzene |
| PubChem CID | 158412093 |
| Molecular Formula | C27H51N |
| Molecular Weight | 389.71 g/mol |
| Exact Mass | 389.40 |
| IUPAC Name | N-methylpropan-2-amine;1-propyl-2-tetradecylbenzene |
| SMILES | CCCCCCCCCCCCCCc1ccccc1CCC.CNC(C)C |
| InChI | InChI=1S/C23H40.C4H11N/c1-3-5-6-7-8-9-10-11-12-13-14-15-19-23-21-17-16-20-22(23)18-4-2;1-4(2)5-3/h16-17,20-21H,3-15,18-19H2,1-2H3;4-5H,1-3H3 |
| InChIKey | GZKZYDFIRXYLQL-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.71 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methylpropan-2-amine;1-propyl-2-tetradecylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylpropan-2-amine;1-propyl-2-tetradecylbenzene?
The IUPAC name of N-methylpropan-2-amine;1-propyl-2-tetradecylbenzene (CID 158412093) is N-methylpropan-2-amine;1-propyl-2-tetradecylbenzene.
What is the SMILES notation for N-methylpropan-2-amine;1-propyl-2-tetradecylbenzene?
The canonical SMILES for N-methylpropan-2-amine;1-propyl-2-tetradecylbenzene is CCCCCCCCCCCCCCc1ccccc1CCC.CNC(C)C.
What is the InChIKey of N-methylpropan-2-amine;1-propyl-2-tetradecylbenzene?
The InChIKey is GZKZYDFIRXYLQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H40.C4H11N/c1-3-5-6-7-8-9-10-11-12-13-14-15-19-23-21-17-16-20-22(23)18-4-2;1-4(2)5-3/h16-17,20-21H,3-15,18-19H2,1-2H3;4-5H,1-3H3.
What are the key properties of N-methylpropan-2-amine;1-propyl-2-tetradecylbenzene?
N-methylpropan-2-amine;1-propyl-2-tetradecylbenzene has a molecular weight of 389.71 g/mol, XLogP of 8.50, 16 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylpropan-2-amine;1-propyl-2-tetradecylbenzene is sourced from PubChem (CID 158412093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).