C13H17NO5 — CID 158436057
benzene-1,2,3-triol;N-ethyl-N-formyl-2-methylprop-2-enamide (PubChem CID 158436057) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is benzene-1,2,3-triol;N-ethyl-N-formyl-2-methylprop-2-enamide.
| Compound Name | benzene-1,2,3-triol;N-ethyl-N-formyl-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 158436057 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | benzene-1,2,3-triol;N-ethyl-N-formyl-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(C=O)CC.Oc1cccc(O)c1O |
| InChI | InChI=1S/C7H11NO2.C6H6O3/c1-4-8(5-9)7(10)6(2)3;7-4-2-1-3-5(8)6(4)9/h5H,2,4H2,1,3H3;1-3,7-9H |
| InChIKey | HCFUGZHEZFLFPF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|