C22H17F4NO3S — CID 158449479
1-[4-[3-fluoro-5-(trifluoromethyl)phenyl]sulfonylphenyl]-4-pyridin-3-ylbutan-2-one (PubChem CID 158449479) has the molecular formula C22H17F4NO3S and a molecular weight of 451.44 g/mol. Its IUPAC name is 1-[4-[3-fluoro-5-(trifluoromethyl)phenyl]sulfonylphenyl]-4-pyridin-3-ylbutan-2-one.
| Compound Name | 1-[4-[3-fluoro-5-(trifluoromethyl)phenyl]sulfonylphenyl]-4-pyridin-3-ylbutan-2-one |
|---|---|
| PubChem CID | 158449479 |
| Molecular Formula | C22H17F4NO3S |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 1-[4-[3-fluoro-5-(trifluoromethyl)phenyl]sulfonylphenyl]-4-pyridin-3-ylbutan-2-one |
| SMILES | O=C(CCc1cccnc1)Cc1ccc(S(=O)(=O)c2cc(F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H17F4NO3S/c23-18-11-17(22(24,25)26)12-21(13-18)31(29,30)20-7-4-15(5-8-20)10-19(28)6-3-16-2-1-9-27-14-16/h1-2,4-5,7-9,11-14H,3,6,10H2 |
| InChIKey | HDUOKQCAKYDRHC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |